CAS 1379602-81-9 is the registry number for sodium (2r)-2-[(4s)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Sodium (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetate (CAS 1379602-81-9) is a chemical compound with the molecular formula C7H11NaO5 and a molecular weight of 198.15 g/mol. IUPAC name: sodium (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetate. InChIKey: RRQJWSNQRPCTRX-UYXJWNHNSA-M.
| Molecular formula | C7H11NaO5 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | sodium (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-hydroxyacetate |
| InChIKey | RRQJWSNQRPCTRX-UYXJWNHNSA-M |
| SMILES | CC1(OC[C@H](O1)[C@H](C(=O)[O-])O)C.[Na+] |
Computed by PubChem (NCBI)