CAS 927806-95-9 is the registry number for Regadenoson Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium (Z)-2-(dimethoxymethyl)-3-methoxy-3-oxoprop-1-en-1-olate (CAS 927806-95-9) is a chemical compound with the molecular formula C7H11NaO5 and a molecular weight of 198.15 g/mol. IUPAC name: sodium (Z)-2-(dimethoxymethyl)-3-methoxy-3-oxoprop-1-en-1-olate. InChIKey: XCZUGFTZFZMPFD-FXRZFVDSSA-M.
| Molecular formula | C7H11NaO5 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | sodium (Z)-2-(dimethoxymethyl)-3-methoxy-3-oxoprop-1-en-1-olate |
| InChIKey | XCZUGFTZFZMPFD-FXRZFVDSSA-M |
| SMILES | COC(/C(=C/[O-])/C(=O)OC)OC.[Na+] |
Computed by PubChem (NCBI)