CAS 50628-37-0 is the registry number for Sodium (e)-2-(dimethoxymethyl)-3-methoxy-3-oxoprop-1-en-1-olate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Sodium (E)-2-(dimethoxymethyl)-3-methoxy-3-oxoprop-1-en-1-olate (CAS 50628-37-0) is a chemical compound with the molecular formula C7H11NaO5 and a molecular weight of 198.15 g/mol. IUPAC name: sodium (E)-2-(dimethoxymethyl)-3-methoxy-3-oxoprop-1-en-1-olate. InChIKey: XCZUGFTZFZMPFD-MKWAYWHRSA-M.
| Molecular formula | C7H11NaO5 |
|---|---|
| Molecular weight | 198.15 g/mol |
| IUPAC name | sodium (E)-2-(dimethoxymethyl)-3-methoxy-3-oxoprop-1-en-1-olate |
| InChIKey | XCZUGFTZFZMPFD-MKWAYWHRSA-M |
| SMILES | COC(/C(=C\[O-])/C(=O)OC)OC.[Na+] |
Computed by PubChem (NCBI)