Products 138-12-5
CAS 138-12-5 is the registry number for (±)-Scopolamine. Offered by: MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg.
[(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate (CAS 138-12-5) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: [(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate. InChIKey: STECJAGHUSJQJN-QBMZJCKTSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | [(1S,2S,4R,5R)-9-methyl-3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate |
| InChIKey | STECJAGHUSJQJN-QBMZJCKTSA-N |
| SMILES | CN1[C@@H]2CC(C[C@H]1[C@H]3[C@@H]2O3)OC(=O)C(CO)C4=CC=CC=C4 |
Computed by PubChem (NCBI)