CAS 1380202-32-3 appears in our catalog under these names: 2,2-Difluoro-2-(2-fluorophenyl)ethanol, 98%, 2，2–difluoro–2–(2–fluorophenyl)ethan–1–ol, 2,2-Difluoro-2-(2-fluorophenyl)ethanol, 96%, 96%, 2,2-Difluoro-2-(2-fluorophenyl)ethan-1-ol, 96%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 10mg, 1g, 250mg.
2,2-difluoro-2-(2-fluorophenyl)ethanol (CAS 1380202-32-3) is a chemical compound with the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. IUPAC name: 2,2-difluoro-2-(2-fluorophenyl)ethanol. InChIKey: XPWFTORDCSZNQQ-UHFFFAOYSA-N.
| Molecular formula | C8H7F3O |
|---|---|
| Molecular weight | 176.14 g/mol |
| IUPAC name | 2,2-difluoro-2-(2-fluorophenyl)ethanol |
| InChIKey | XPWFTORDCSZNQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(CO)(F)F)F |
Computed by PubChem (NCBI)