CAS 1380300-54-8 is the registry number for 4,4-Difluoro-1-(pyridin-2-ylmethyl)cyclohexan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4,4-difluoro-1-(pyridin-2-ylmethyl)cyclohexan-1-amine;dihydrochloride (CAS 1380300-54-8) is a chemical compound with the molecular formula C12H18Cl2F2N2 and a molecular weight of 299.18 g/mol. IUPAC name: 4,4-difluoro-1-(pyridin-2-ylmethyl)cyclohexan-1-amine;dihydrochloride. InChIKey: NNIORLJTYJAVPW-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2F2N2 |
|---|---|
| Molecular weight | 299.18 g/mol |
| IUPAC name | 4,4-difluoro-1-(pyridin-2-ylmethyl)cyclohexan-1-amine;dihydrochloride |
| InChIKey | NNIORLJTYJAVPW-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1(CC2=CC=CC=N2)N)(F)F.Cl.Cl |
Computed by PubChem (NCBI)