CAS 328083-91-6 is the registry number for 1-(3,4-Difluorobenzyl)piperidin-4-amine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-[(3,4-difluorophenyl)methyl]piperidin-4-amine;dihydrochloride (CAS 328083-91-6) is a chemical compound with the molecular formula C12H18Cl2F2N2 and a molecular weight of 299.18 g/mol. IUPAC name: 1-[(3,4-difluorophenyl)methyl]piperidin-4-amine;dihydrochloride. InChIKey: IOKYHLYDSQRSGF-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2F2N2 |
|---|---|
| Molecular weight | 299.18 g/mol |
| IUPAC name | 1-[(3,4-difluorophenyl)methyl]piperidin-4-amine;dihydrochloride |
| InChIKey | IOKYHLYDSQRSGF-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)CC2=CC(=C(C=C2)F)F.Cl.Cl |
Computed by PubChem (NCBI)