CAS 2126163-02-6 is the registry number for 1-(2,4-Difluorophenyl)-5-methyl-1,4-diazepane dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2,4-difluorophenyl)-5-methyl-1,4-diazepane;dihydrochloride (CAS 2126163-02-6) is a chemical compound with the molecular formula C12H18Cl2F2N2 and a molecular weight of 299.18 g/mol. IUPAC name: 1-(2,4-difluorophenyl)-5-methyl-1,4-diazepane;dihydrochloride. InChIKey: XLQIIARQBVFIHK-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2F2N2 |
|---|---|
| Molecular weight | 299.18 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)-5-methyl-1,4-diazepane;dihydrochloride |
| InChIKey | XLQIIARQBVFIHK-UHFFFAOYSA-N |
| SMILES | CC1CCN(CCN1)C2=C(C=C(C=C2)F)F.Cl.Cl |
Computed by PubChem (NCBI)