Products 138047-56-0
CAS 138047-56-0 is the registry number for CP-283097. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,4S)-3-(4-benzyl-4-hydroxypiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol (CAS 138047-56-0) is a chemical compound with the molecular formula C21H25NO4 and a molecular weight of 355.4 g/mol. IUPAC name: (3R,4S)-3-(4-benzyl-4-hydroxypiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol. InChIKey: JQQWDYJWDCIVKQ-QUCCMNQESA-N.
| Molecular formula | C21H25NO4 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (3R,4S)-3-(4-benzyl-4-hydroxypiperidin-1-yl)-3,4-dihydro-2H-chromene-4,7-diol |
| InChIKey | JQQWDYJWDCIVKQ-QUCCMNQESA-N |
| SMILES | C1CN(CCC1(CC2=CC=CC=C2)O)[C@@H]3COC4=C([C@@H]3O)C=CC(=C4)O |
Computed by PubChem (NCBI)