CAS 138168-21-5 appears in our catalog under these names: 3-Azido-2,3-dideoxy-D-erythropentose, 3-Azido-2,3-dideoxy-D-ribose. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 1g.
(3S,4S)-3-azido-4,5-dihydroxypentanal (CAS 138168-21-5) is a chemical compound with the molecular formula C5H9N3O3 and a molecular weight of 159.14 g/mol. IUPAC name: (3S,4S)-3-azido-4,5-dihydroxypentanal. InChIKey: CCRXJMDIIXJVIC-CRCLSJGQSA-N.
| Molecular formula | C5H9N3O3 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | (3S,4S)-3-azido-4,5-dihydroxypentanal |
| InChIKey | CCRXJMDIIXJVIC-CRCLSJGQSA-N |
| SMILES | C(C=O)[C@@H]([C@@H](CO)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)