Products 2089257-22-5

CAS 2089257-22-5 is the registry number for 2-Amino-4-methyl-1h-imidazole-5-carboxylic acid hydrate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.

Structural formula: {0} (CAS {1})

2-amino-5-methyl-1H-imidazole-4-carboxylic acid;hydrate (CAS 2089257-22-5) is a chemical compound with the molecular formula C5H9N3O3 and a molecular weight of 159.14 g/mol. IUPAC name: 2-amino-5-methyl-1H-imidazole-4-carboxylic acid;hydrate. InChIKey: MLRBCLCABWQWLZ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9N3O3
Molecular weight159.14 g/mol
IUPAC name2-amino-5-methyl-1H-imidazole-4-carboxylic acid;hydrate
InChIKeyMLRBCLCABWQWLZ-UHFFFAOYSA-N
SMILESCC1=C(N=C(N1)N)C(=O)O.O

Computed by PubChem (NCBI)