CAS 549504-45-2 is the registry number for (2S)-3-Azido-2-hydroxy-2-methyl-propanoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
Methyl (2S)-3-azido-2-hydroxy-2-methylpropanoate (CAS 549504-45-2) is a chemical compound with the molecular formula C5H9N3O3 and a molecular weight of 159.14 g/mol. IUPAC name: methyl (2S)-3-azido-2-hydroxy-2-methylpropanoate. InChIKey: IFZQXKZFIXWPKR-YFKPBYRVSA-N.
| Molecular formula | C5H9N3O3 |
|---|---|
| Molecular weight | 159.14 g/mol |
| IUPAC name | methyl (2S)-3-azido-2-hydroxy-2-methylpropanoate |
| InChIKey | IFZQXKZFIXWPKR-YFKPBYRVSA-N |
| SMILES | C[C@](CN=[N+]=[N-])(C(=O)OC)O |
Computed by PubChem (NCBI)