Products 1381846-32-7
CAS 1381846-32-7 is the registry number for 5-(((tert-Butoxycarbonyl)amino)methyl)-2-(trifluoromethyl)benzoic acid, 97%. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-(trifluoromethyl)benzoic acid (CAS 1381846-32-7) is a chemical compound with the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. IUPAC name: 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-(trifluoromethyl)benzoic acid. InChIKey: YQQBNEKPJXALKN-UHFFFAOYSA-N.
| Molecular formula | C14H16F3NO4 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | 5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-(trifluoromethyl)benzoic acid |
| InChIKey | YQQBNEKPJXALKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)