Products 1381856-75-2
CAS 1381856-75-2 is the registry number for N-(Benzo[d]thiazol-2-yl)-2-bromopropanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-benzothiazol-2-yl)-2-bromopropanamide (CAS 1381856-75-2) is a chemical compound with the molecular formula C10H9BrN2OS and a molecular weight of 285.16 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)-2-bromopropanamide. InChIKey: RZPANBGHHYTSJL-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2OS |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)-2-bromopropanamide |
| InChIKey | RZPANBGHHYTSJL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=NC2=CC=CC=C2S1)Br |
Computed by PubChem (NCBI)