CAS 189011-00-5 appears in our catalog under these names: 4-(3-Bromo-4-methoxyphenyl)-1,3-thiazol-2-amine, 95%, 4-(3-Bromo-4-methoxyphenyl)thiazol-2-amine, 97%, 4-(3-Bromo-4-methoxyphenyl)-1,3-thiazol-2-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 5g, 1g, 2,5g.
4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-amine (CAS 189011-00-5) is a chemical compound with the molecular formula C10H9BrN2OS and a molecular weight of 285.16 g/mol. IUPAC name: 4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-amine. InChIKey: VWSACNUWIZRJGM-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2OS |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | 4-(3-bromo-4-methoxyphenyl)-1,3-thiazol-2-amine |
| InChIKey | VWSACNUWIZRJGM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CSC(=N2)N)Br |
Computed by PubChem (NCBI)