CAS 63500-83-4 is the registry number for 2-((4-Bromophenyl)imino)-3-methylthiazolidin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)imino-3-methyl-1,3-thiazolidin-4-one (CAS 63500-83-4) is a chemical compound with the molecular formula C10H9BrN2OS and a molecular weight of 285.16 g/mol. IUPAC name: 2-(4-bromophenyl)imino-3-methyl-1,3-thiazolidin-4-one. InChIKey: KAANEANCBKKQLE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2OS |
|---|---|
| Molecular weight | 285.16 g/mol |
| IUPAC name | 2-(4-bromophenyl)imino-3-methyl-1,3-thiazolidin-4-one |
| InChIKey | KAANEANCBKKQLE-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CSC1=NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)