CAS 1381928-56-8 appears in our catalog under these names: (2R)-2-(6-Chloro-2-fluorophenyl)pyrrolidine hydrochloride, 95%, (R)–2–(2–Chloro–6–fluorophenyl)pyrrolidine hydrochloride, (R)-2-(2-Chloro-6-fluorophenyl)pyrrolidine hydrochloride, 95%, 95%, (R)-2-(2-Chloro-6-fluorophenyl)pyrrolidine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(2R)-2-(2-chloro-6-fluorophenyl)pyrrolidine;hydrochloride (CAS 1381928-56-8) is a chemical compound with the molecular formula C10H12Cl2FN and a molecular weight of 236.11 g/mol. IUPAC name: (2R)-2-(2-chloro-6-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: VRRMWHPZTXGTTO-SBSPUUFOSA-N.
| Molecular formula | C10H12Cl2FN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | (2R)-2-(2-chloro-6-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | VRRMWHPZTXGTTO-SBSPUUFOSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC=C2Cl)F.Cl |
Computed by PubChem (NCBI)