CAS 1909327-49-6 appears in our catalog under these names: 7-chloro-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 7-Chloro-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
7-chloro-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 1909327-49-6) is a chemical compound with the molecular formula C10H12Cl2FN and a molecular weight of 236.11 g/mol. IUPAC name: 7-chloro-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: RVCISOUIADQGSF-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2FN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | 7-chloro-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | RVCISOUIADQGSF-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC(=C2)Cl)F)N.Cl |
Computed by PubChem (NCBI)