Products 1381929-04-9
CAS 1381929-04-9 appears in our catalog under these names: (R)-2-(2-Chloro-4-fluorophenyl)pyrrolidine hydrochloride, 98%, 98%, (R)-2-(2-Chloro-4-fluorophenyl)pyrrolidine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-(2-chloro-4-fluorophenyl)pyrrolidine;hydrochloride (CAS 1381929-04-9) is a chemical compound with the molecular formula C10H12Cl2FN and a molecular weight of 236.11 g/mol. IUPAC name: (2R)-2-(2-chloro-4-fluorophenyl)pyrrolidine;hydrochloride. InChIKey: MEQDBZDOFUTQML-HNCPQSOCSA-N.
| Molecular formula | C10H12Cl2FN |
|---|---|
| Molecular weight | 236.11 g/mol |
| IUPAC name | (2R)-2-(2-chloro-4-fluorophenyl)pyrrolidine;hydrochloride |
| InChIKey | MEQDBZDOFUTQML-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=C(C=C2)F)Cl.Cl |
Computed by PubChem (NCBI)