CAS 1381944-77-9 is the registry number for 4-Bromo-N-isopropylnaphthalene-1-carboxamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
4-bromo-N-propan-2-ylnaphthalene-1-carboxamide (CAS 1381944-77-9) is a chemical compound with the molecular formula C14H14BrNO and a molecular weight of 292.17 g/mol. IUPAC name: 4-bromo-N-propan-2-ylnaphthalene-1-carboxamide. InChIKey: UIKDFYLOBJKGHT-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO |
|---|---|
| Molecular weight | 292.17 g/mol |
| IUPAC name | 4-bromo-N-propan-2-ylnaphthalene-1-carboxamide |
| InChIKey | UIKDFYLOBJKGHT-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC=C(C2=CC=CC=C21)Br |
Computed by PubChem (NCBI)