CAS 210832-86-3 appears in our catalog under these names: 6-Bromoacetyl-2-dimethylaminonaphthalene, >95% (HPLC), BADAN. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 5 mg, 1 mg.
2-bromo-1-[6-(dimethylamino)naphthalen-2-yl]ethanone (CAS 210832-86-3) is a chemical compound with the molecular formula C14H14BrNO and a molecular weight of 292.17 g/mol. IUPAC name: 2-bromo-1-[6-(dimethylamino)naphthalen-2-yl]ethanone. InChIKey: ZEIHZWQYRTVVMA-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO |
|---|---|
| Molecular weight | 292.17 g/mol |
| IUPAC name | 2-bromo-1-[6-(dimethylamino)naphthalen-2-yl]ethanone |
| InChIKey | ZEIHZWQYRTVVMA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)