CAS 886362-84-1 appears in our catalog under these names: 1-(4-Bromophenyl)-1-(4-methoxyphenyl)methylamine, 95%, (4-Bromophenyl)(4-methoxyphenyl)methanamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
(4-bromophenyl)-(4-methoxyphenyl)methanamine (CAS 886362-84-1) is a chemical compound with the molecular formula C14H14BrNO and a molecular weight of 292.17 g/mol. IUPAC name: (4-bromophenyl)-(4-methoxyphenyl)methanamine. InChIKey: GSXAISCLDOQZOQ-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO |
|---|---|
| Molecular weight | 292.17 g/mol |
| IUPAC name | (4-bromophenyl)-(4-methoxyphenyl)methanamine |
| InChIKey | GSXAISCLDOQZOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)