CAS 13829-06-6 is the registry number for N-(Chloro(dimethylamino)methylene)-N-methylmethanaminium chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
[chloro(dimethylamino)methylidene]-dimethylazanium chloride (CAS 13829-06-6) is a chemical compound with the molecular formula C5H12Cl2N2 and a molecular weight of 171.07 g/mol. IUPAC name: [chloro(dimethylamino)methylidene]-dimethylazanium chloride. InChIKey: UWMLSXCBFHQUTH-UHFFFAOYSA-M.
| Molecular formula | C5H12Cl2N2 |
|---|---|
| Molecular weight | 171.07 g/mol |
| IUPAC name | [chloro(dimethylamino)methylidene]-dimethylazanium chloride |
| InChIKey | UWMLSXCBFHQUTH-UHFFFAOYSA-M |
| SMILES | CN(C)C(=[N+](C)C)Cl.[Cl-] |
Computed by PubChem (NCBI)