Products 13829-06-6

CAS 13829-06-6 is the registry number for N-(Chloro(dimethylamino)methylene)-N-methylmethanaminium chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

[chloro(dimethylamino)methylidene]-dimethylazanium chloride (CAS 13829-06-6) is a chemical compound with the molecular formula C5H12Cl2N2 and a molecular weight of 171.07 g/mol. IUPAC name: [chloro(dimethylamino)methylidene]-dimethylazanium chloride. InChIKey: UWMLSXCBFHQUTH-UHFFFAOYSA-M.

Identity
Molecular formulaC5H12Cl2N2
Molecular weight171.07 g/mol
IUPAC name[chloro(dimethylamino)methylidene]-dimethylazanium chloride
InChIKeyUWMLSXCBFHQUTH-UHFFFAOYSA-M
SMILESCN(C)C(=[N+](C)C)Cl.[Cl-]

Computed by PubChem (NCBI)