CAS 2331211-51-7 appears in our catalog under these names: (1R, 4R)-2,5-Diaza-bicyclo[2.2.1]heptane dihydrochloride, 97%, 97%, (1R, 4R)-2,5-Diaza-bicyclo[2.2.1]heptane dihydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
(1R,4R)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CAS 2331211-51-7) is a chemical compound with the molecular formula C5H12Cl2N2 and a molecular weight of 171.07 g/mol. IUPAC name: (1R,4R)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: PIDOCGDMKRSJMT-ALUAXPQUSA-N.
| Molecular formula | C5H12Cl2N2 |
|---|---|
| Molecular weight | 171.07 g/mol |
| IUPAC name | (1R,4R)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | PIDOCGDMKRSJMT-ALUAXPQUSA-N |
| SMILES | C1[C@@H]2CN[C@H]1CN2.Cl.Cl |
Computed by PubChem (NCBI)