CAS 5260-20-8 appears in our catalog under these names: (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrochloride, 95%, (1S,4S)-2,5-Diazabicyclo(2.2.1)heptane dihydrochloride, 97%, 2,5-Diazabicyclo(2.2.1)heptane, dihydrochloride, (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane Dihydrochloride, 97%, 97%, (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 10g, 500mg, 5g.
(1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride (CAS 5260-20-8) is a chemical compound with the molecular formula C5H12Cl2N2 and a molecular weight of 171.07 g/mol. IUPAC name: (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride. InChIKey: PIDOCGDMKRSJMT-RSLHMRQOSA-N.
| Molecular formula | C5H12Cl2N2 |
|---|---|
| Molecular weight | 171.07 g/mol |
| IUPAC name | (1S,4S)-2,5-diazabicyclo[2.2.1]heptane;dihydrochloride |
| InChIKey | PIDOCGDMKRSJMT-RSLHMRQOSA-N |
| SMILES | C1[C@H]2CN[C@@H]1CN2.Cl.Cl |
Computed by PubChem (NCBI)