Products 138308-53-9
CAS 138308-53-9 is the registry number for 1-Methyl-3-phenyl-2-naphthol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-methyl-3-phenylnaphthalen-2-ol (CAS 138308-53-9) is a chemical compound with the molecular formula C17H14O and a molecular weight of 234.29 g/mol. IUPAC name: 1-methyl-3-phenylnaphthalen-2-ol. InChIKey: CSIPDAUYIACQJS-UHFFFAOYSA-N.
| Molecular formula | C17H14O |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 1-methyl-3-phenylnaphthalen-2-ol |
| InChIKey | CSIPDAUYIACQJS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC2=CC=CC=C12)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)