Products 613-62-7
CAS 613-62-7 appears in our catalog under these names: Benzyl 2-Naphthyl Ether, Benzyl 2-Naphthyl Ether, >98.0%(GC), Benzyl 2-Naphthyl Ether 98%, Benzyl 2-Naphthyl Ether, 98%, 98%, Benzyl 2-naphthyl ether, 99.44%. Offered by: Mikromol, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 25g, 500g, 100g, 1000g, 100 g, 50 g, 200g.
2-phenylmethoxynaphthalene (CAS 613-62-7) is a chemical compound with the molecular formula C17H14O and a molecular weight of 234.29 g/mol. IUPAC name: 2-phenylmethoxynaphthalene. InChIKey: WLTCCDHHWYAMCG-UHFFFAOYSA-N.
| Molecular formula | C17H14O |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 2-phenylmethoxynaphthalene |
| InChIKey | WLTCCDHHWYAMCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)