CAS 858258-61-4 is the registry number for 1,10b-Dihydro-2-methyl-3(2H)-fluoranthenone. Offered by: TRC. Available pack sizes: 100mg.
2-methyl-2,10b-dihydro-1H-fluoranthen-3-one (CAS 858258-61-4) is a chemical compound with the molecular formula C17H14O and a molecular weight of 234.29 g/mol. IUPAC name: 2-methyl-2,10b-dihydro-1H-fluoranthen-3-one. InChIKey: ZTIXUHYXURZUDC-UHFFFAOYSA-N.
| Molecular formula | C17H14O |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | 2-methyl-2,10b-dihydro-1H-fluoranthen-3-one |
| InChIKey | ZTIXUHYXURZUDC-UHFFFAOYSA-N |
| SMILES | CC1CC2C3=CC=CC=C3C4=C2C(=CC=C4)C1=O |
Computed by PubChem (NCBI)