CAS 138345-00-3 is the registry number for 7,9-Di-tert-butyl-1-oxaspiro(4,5)deca-6,9-dien-8-one. Offered by: TRC. Available pack sizes: 100mg.
7,9-ditert-butyl-1-oxaspiro[4.5]deca-6,9-dien-8-one (CAS 138345-00-3) is a chemical compound with the molecular formula C17H26O2 and a molecular weight of 262.4 g/mol. IUPAC name: 7,9-ditert-butyl-1-oxaspiro[4.5]deca-6,9-dien-8-one. InChIKey: NXVCHTCAMYVBEC-UHFFFAOYSA-N.
| Molecular formula | C17H26O2 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 7,9-ditert-butyl-1-oxaspiro[4.5]deca-6,9-dien-8-one |
| InChIKey | NXVCHTCAMYVBEC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2(CCCO2)C=C(C1=O)C(C)(C)C |
Computed by PubChem (NCBI)