Products 42288-01-7

CAS 42288-01-7 is the registry number for 3-(3,5-Di-tert-butylphenyl)propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

3-(3,5-ditert-butylphenyl)propanoic acid (CAS 42288-01-7) is a chemical compound with the molecular formula C17H26O2 and a molecular weight of 262.4 g/mol. IUPAC name: 3-(3,5-ditert-butylphenyl)propanoic acid. InChIKey: WTYBGPKEFLHQFK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26O2
Molecular weight262.4 g/mol
IUPAC name3-(3,5-ditert-butylphenyl)propanoic acid
InChIKeyWTYBGPKEFLHQFK-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC(=CC(=C1)CCC(=O)O)C(C)(C)C

Computed by PubChem (NCBI)