CAS 5452-61-9 is the registry number for Ethyl 3-methyl-5-(2,6,6-trimethylcyclohex-1-en-1-yl)penta-2,4-dienoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienoate (CAS 5452-61-9) is a chemical compound with the molecular formula C17H26O2 and a molecular weight of 262.4 g/mol. IUPAC name: ethyl (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienoate. InChIKey: DNGMNNGDXRUXFV-OKLKQMLOSA-N.
| Molecular formula | C17H26O2 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | ethyl (2E,4E)-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-2,4-dienoate |
| InChIKey | DNGMNNGDXRUXFV-OKLKQMLOSA-N |
| SMILES | CCOC(=O)/C=C(\C)/C=C/C1=C(CCCC1(C)C)C |
Computed by PubChem (NCBI)