Products 1383546-18-6

CAS 1383546-18-6 is the registry number for 5-Iodo-3-methyl-1,2-thiazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5-iodo-3-methyl-1,2-thiazole-4-carboxylic acid (CAS 1383546-18-6) is a chemical compound with the molecular formula C5H4INO2S and a molecular weight of 269.06 g/mol. IUPAC name: 5-iodo-3-methyl-1,2-thiazole-4-carboxylic acid. InChIKey: XTIWMXFCHBNILL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4INO2S
Molecular weight269.06 g/mol
IUPAC name5-iodo-3-methyl-1,2-thiazole-4-carboxylic acid
InChIKeyXTIWMXFCHBNILL-UHFFFAOYSA-N
SMILESCC1=NSC(=C1C(=O)O)I

Computed by PubChem (NCBI)