Products 2137620-36-9

CAS 2137620-36-9 is the registry number for Methyl 5-iodo-1,2-thiazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-iodo-1,2-thiazole-3-carboxylate (CAS 2137620-36-9) is a chemical compound with the molecular formula C5H4INO2S and a molecular weight of 269.06 g/mol. IUPAC name: methyl 5-iodo-1,2-thiazole-3-carboxylate. InChIKey: LHVQXVTVVMMXOL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4INO2S
Molecular weight269.06 g/mol
IUPAC namemethyl 5-iodo-1,2-thiazole-3-carboxylate
InChIKeyLHVQXVTVVMMXOL-UHFFFAOYSA-N
SMILESCOC(=O)C1=NSC(=C1)I

Computed by PubChem (NCBI)