Products 1824080-65-0

CAS 1824080-65-0 is the registry number for 2-(2-Iodothiazol-4-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-iodo-1,3-thiazol-4-yl)acetic acid (CAS 1824080-65-0) is a chemical compound with the molecular formula C5H4INO2S and a molecular weight of 269.06 g/mol. IUPAC name: 2-(2-iodo-1,3-thiazol-4-yl)acetic acid. InChIKey: GZZCLTQVFCRFTO-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4INO2S
Molecular weight269.06 g/mol
IUPAC name2-(2-iodo-1,3-thiazol-4-yl)acetic acid
InChIKeyGZZCLTQVFCRFTO-UHFFFAOYSA-N
SMILESC1=C(N=C(S1)I)CC(=O)O

Computed by PubChem (NCBI)