CAS 1383715-05-6 is the registry number for Longipenamide B. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,6R,7E,9R)-6,9-dihydroxy-N-(2-methylpropyl)deca-2,7-dienamide (CAS 1383715-05-6) is a chemical compound with the molecular formula C14H25NO3 and a molecular weight of 255.35 g/mol. IUPAC name: (2E,6R,7E,9R)-6,9-dihydroxy-N-(2-methylpropyl)deca-2,7-dienamide. InChIKey: FEUMKDRLSICPNR-MWBBVWBASA-N.
| Molecular formula | C14H25NO3 |
|---|---|
| Molecular weight | 255.35 g/mol |
| IUPAC name | (2E,6R,7E,9R)-6,9-dihydroxy-N-(2-methylpropyl)deca-2,7-dienamide |
| InChIKey | FEUMKDRLSICPNR-MWBBVWBASA-N |
| SMILES | C[C@H](/C=C/[C@@H](CC/C=C/C(=O)NCC(C)C)O)O |
Computed by PubChem (NCBI)