CAS 1383916-83-3 appears in our catalog under these names: 6,6',6''–(Benzene–1,3,5–triyl)tris(2–naphthoic acid), 6,6',6''-(Benzene-1,3,5-triyl)tris(2-naphthoic acid), 97%, 97%, 6,6',6''-(Benzene-1,3,5-triyl)tris(2-naphthoic acid), 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
6-[3,5-bis(6-carboxynaphthalen-2-yl)phenyl]naphthalene-2-carboxylic acid (CAS 1383916-83-3) is a chemical compound with the molecular formula C39H24O6 and a molecular weight of 588.6 g/mol. IUPAC name: 6-[3,5-bis(6-carboxynaphthalen-2-yl)phenyl]naphthalene-2-carboxylic acid. InChIKey: VTROUXWDAQESAI-UHFFFAOYSA-N.
| Molecular formula | C39H24O6 |
|---|---|
| Molecular weight | 588.6 g/mol |
| IUPAC name | 6-[3,5-bis(6-carboxynaphthalen-2-yl)phenyl]naphthalene-2-carboxylic acid |
| InChIKey | VTROUXWDAQESAI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C(=O)O)C=C1C3=CC(=CC(=C3)C4=CC5=C(C=C4)C=C(C=C5)C(=O)O)C6=CC7=C(C=C6)C=C(C=C7)C(=O)O |
Computed by PubChem (NCBI)