CAS 1404116-13-7 is the registry number for 5,5',5''-(Benzene-1,3,5-triyl)tris(1-naphthoic acid), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[3,5-bis(5-carboxynaphthalen-1-yl)phenyl]naphthalene-1-carboxylic acid (CAS 1404116-13-7) is a chemical compound with the molecular formula C39H24O6 and a molecular weight of 588.6 g/mol. IUPAC name: 5-[3,5-bis(5-carboxynaphthalen-1-yl)phenyl]naphthalene-1-carboxylic acid. InChIKey: IACSRELHPGIBKK-UHFFFAOYSA-N.
| Molecular formula | C39H24O6 |
|---|---|
| Molecular weight | 588.6 g/mol |
| IUPAC name | 5-[3,5-bis(5-carboxynaphthalen-1-yl)phenyl]naphthalene-1-carboxylic acid |
| InChIKey | IACSRELHPGIBKK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC=C2C(=O)O)C(=C1)C3=CC(=CC(=C3)C4=CC=CC5=C4C=CC=C5C(=O)O)C6=CC=CC7=C6C=CC=C7C(=O)O |
Computed by PubChem (NCBI)