CAS 1660960-34-8 appears in our catalog under these names: 4,4',4''-(Benzene-1,3,5-triyl)tris(1-naphthoic acid), 97%, 97%, 4,4',4''-(Benzene-1,3,5-triyl)tris(1-naphthoic acid), 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-[3,5-bis(4-carboxynaphthalen-1-yl)phenyl]naphthalene-1-carboxylic acid (CAS 1660960-34-8) is a chemical compound with the molecular formula C39H24O6 and a molecular weight of 588.6 g/mol. IUPAC name: 4-[3,5-bis(4-carboxynaphthalen-1-yl)phenyl]naphthalene-1-carboxylic acid. InChIKey: GWOUWUOUMRYBIG-UHFFFAOYSA-N.
| Molecular formula | C39H24O6 |
|---|---|
| Molecular weight | 588.6 g/mol |
| IUPAC name | 4-[3,5-bis(4-carboxynaphthalen-1-yl)phenyl]naphthalene-1-carboxylic acid |
| InChIKey | GWOUWUOUMRYBIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C3=CC(=CC(=C3)C4=CC=C(C5=CC=CC=C54)C(=O)O)C6=CC=C(C7=CC=CC=C76)C(=O)O |
Computed by PubChem (NCBI)