CAS 1384081-16-6 is the registry number for Methyl 3-(2,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate (CAS 1384081-16-6) is a chemical compound with the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. IUPAC name: methyl 3-(2,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: IYHIKZPJIAUHDL-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O3 |
|---|---|
| Molecular weight | 273.07 g/mol |
| IUPAC name | methyl 3-(2,5-dichlorophenyl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | IYHIKZPJIAUHDL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=NO1)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)