Products 471909-51-0

CAS 471909-51-0 is the registry number for 3-(3,5-Dichloropyridin-4-yl)-5-methylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3,5-dichloro-4-pyridinyl)-5-methyl-1,2-oxazole-4-carboxylic acid (CAS 471909-51-0) is a chemical compound with the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. IUPAC name: 3-(3,5-dichloro-4-pyridinyl)-5-methyl-1,2-oxazole-4-carboxylic acid. InChIKey: KLPDCWGRQSGWGX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6Cl2N2O3
Molecular weight273.07 g/mol
IUPAC name3-(3,5-dichloro-4-pyridinyl)-5-methyl-1,2-oxazole-4-carboxylic acid
InChIKeyKLPDCWGRQSGWGX-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C2=C(C=NC=C2Cl)Cl)C(=O)O

Computed by PubChem (NCBI)