Products 259180-83-1

CAS 259180-83-1 is the registry number for 2,4-Dichloro-6-methoxy-3-nitroquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

2,4-dichloro-6-methoxy-3-nitroquinoline (CAS 259180-83-1) is a chemical compound with the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. IUPAC name: 2,4-dichloro-6-methoxy-3-nitroquinoline. InChIKey: GLWXGXVYZSUFAG-UHFFFAOYSA-N.

Identity
Molecular formulaC10H6Cl2N2O3
Molecular weight273.07 g/mol
IUPAC name2,4-dichloro-6-methoxy-3-nitroquinoline
InChIKeyGLWXGXVYZSUFAG-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)N=C(C(=C2Cl)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)