CAS 259180-83-1 is the registry number for 2,4-Dichloro-6-methoxy-3-nitroquinoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg.
2,4-dichloro-6-methoxy-3-nitroquinoline (CAS 259180-83-1) is a chemical compound with the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. IUPAC name: 2,4-dichloro-6-methoxy-3-nitroquinoline. InChIKey: GLWXGXVYZSUFAG-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O3 |
|---|---|
| Molecular weight | 273.07 g/mol |
| IUPAC name | 2,4-dichloro-6-methoxy-3-nitroquinoline |
| InChIKey | GLWXGXVYZSUFAG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(C(=C2Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)