CAS 1384127-60-9 is the registry number for 2-(3,4-Dimethylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, ≥97%, ≥97%. Offered by: Chemat. Available pack sizes: 100mg, 1g, 5g.
2-(3,4-dimethylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1384127-60-9) is a chemical compound with the molecular formula C12H19BO2S and a molecular weight of 238.16 g/mol. IUPAC name: 2-(3,4-dimethylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IPNMBPRAPHRJPN-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2S |
|---|---|
| Molecular weight | 238.16 g/mol |
| IUPAC name | 2-(3,4-dimethylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IPNMBPRAPHRJPN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CS2)C)C |
Computed by PubChem (NCBI)