Products 1447710-10-2

CAS 1447710-10-2 is the registry number for 5-Ethylthiophene-2-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2-(5-ethylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1447710-10-2) is a chemical compound with the molecular formula C12H19BO2S and a molecular weight of 238.16 g/mol. IUPAC name: 2-(5-ethylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SPNIWDLPUBCHPG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19BO2S
Molecular weight238.16 g/mol
IUPAC name2-(5-ethylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
InChIKeySPNIWDLPUBCHPG-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)CC

Computed by PubChem (NCBI)