CAS 2223032-20-8 appears in our catalog under these names: 2-(5-Ethylthiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2–(5–ethylthiophen–3–yl)–4，4，5，5–tetramethyl–1，3，2–dioxaborolane. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 25mg.
2-(5-ethylthiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2223032-20-8) is a chemical compound with the molecular formula C12H19BO2S and a molecular weight of 238.16 g/mol. IUPAC name: 2-(5-ethylthiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MXXQMXIFGBDGMH-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2S |
|---|---|
| Molecular weight | 238.16 g/mol |
| IUPAC name | 2-(5-ethylthiophen-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MXXQMXIFGBDGMH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)CC |
Computed by PubChem (NCBI)