CAS 138417-35-3 appears in our catalog under these names: 5–(4–Fluorophenyl)–4–methyl–4H–1,2,4–triazole–3–thiol, 5-(4-Fluoro-phenyl)-4-methyl-4H-[1,2,4]triazole-3-thiol, 90%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g.
3-(4-fluorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione (CAS 138417-35-3) is a chemical compound with the molecular formula C9H8FN3S and a molecular weight of 209.25 g/mol. IUPAC name: 3-(4-fluorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione. InChIKey: APKMKRLELRQWEB-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3S |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| InChIKey | APKMKRLELRQWEB-UHFFFAOYSA-N |
| SMILES | CN1C(=NNC1=S)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)