CAS 39181-53-8 appears in our catalog under these names: 5-[(2-Fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine, 95%, 5-(2-Fluorobenzyl)-1,3,4-thiadiazol-2-amine, 95+%, 5-(2-Fluorobenzyl)(1,3,4)thiadiazol-2-ylamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine (CAS 39181-53-8) is a chemical compound with the molecular formula C9H8FN3S and a molecular weight of 209.25 g/mol. IUPAC name: 5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine. InChIKey: KMYBNTVFQUSIQM-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3S |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 5-[(2-fluorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | KMYBNTVFQUSIQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NN=C(S2)N)F |
Computed by PubChem (NCBI)