CAS 299441-62-6 appears in our catalog under these names: 5-(5-Fluoro-2-methylphenyl)-1,3,4-thiadiazol-2-amine, 95%, 5-(5-Fluoro-2-methylphenyl)-1,3,4-thiadiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-(5-fluoro-2-methylphenyl)-1,3,4-thiadiazol-2-amine (CAS 299441-62-6) is a chemical compound with the molecular formula C9H8FN3S and a molecular weight of 209.25 g/mol. IUPAC name: 5-(5-fluoro-2-methylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: FAIIMRSQQQMHPR-UHFFFAOYSA-N.
| Molecular formula | C9H8FN3S |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 5-(5-fluoro-2-methylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | FAIIMRSQQQMHPR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)F)C2=NN=C(S2)N |
Computed by PubChem (NCBI)