CAS 1384427-92-2 is the registry number for N-{2-(5-(2-Chloroacetyl)-2-fluorophenyl)ethyl}acetamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-[2-[5-(2-chloroacetyl)-2-fluorophenyl]ethyl]acetamide (CAS 1384427-92-2) is a chemical compound with the molecular formula C12H13ClFNO2 and a molecular weight of 257.69 g/mol. IUPAC name: N-[2-[5-(2-chloroacetyl)-2-fluorophenyl]ethyl]acetamide. InChIKey: PTPUAQCLFKDGRP-UHFFFAOYSA-N.
| Molecular formula | C12H13ClFNO2 |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | N-[2-[5-(2-chloroacetyl)-2-fluorophenyl]ethyl]acetamide |
| InChIKey | PTPUAQCLFKDGRP-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCC1=C(C=CC(=C1)C(=O)CCl)F |
Computed by PubChem (NCBI)