Products 2270908-86-4
CAS 2270908-86-4 is the registry number for 2-Fluoro-4-(1,2,3,6-tetrahydro-pyridin-4-yl)-benzoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzoic acid;hydrochloride (CAS 2270908-86-4) is a chemical compound with the molecular formula C12H13ClFNO2 and a molecular weight of 257.69 g/mol. IUPAC name: 2-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzoic acid;hydrochloride. InChIKey: XOLOQZLOMBNYDS-UHFFFAOYSA-N.
| Molecular formula | C12H13ClFNO2 |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 2-fluoro-4-(1,2,3,6-tetrahydropyridin-4-yl)benzoic acid;hydrochloride |
| InChIKey | XOLOQZLOMBNYDS-UHFFFAOYSA-N |
| SMILES | C1CNCC=C1C2=CC(=C(C=C2)C(=O)O)F.Cl |
Computed by PubChem (NCBI)