CAS 328233-41-6 is the registry number for 5-Fluoro-3H-spiro[isobenzofuran-1,4'-piperidin]-3-one hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride (CAS 328233-41-6) is a chemical compound with the molecular formula C12H13ClFNO2 and a molecular weight of 257.69 g/mol. IUPAC name: 6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride. InChIKey: SBKQXKRSYOCZEK-UHFFFAOYSA-N.
| Molecular formula | C12H13ClFNO2 |
|---|---|
| Molecular weight | 257.69 g/mol |
| IUPAC name | 6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one;hydrochloride |
| InChIKey | SBKQXKRSYOCZEK-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=C(C=C3)F)C(=O)O2.Cl |
Computed by PubChem (NCBI)